missing translation for 'onlineSavingsMsg'
Learn More
Learn More
MOPS, 1.0 M Pufferlösung, pH 9.0, Thermo Scientific™
71.20 € - 85.09 €
Chemische Identifikatoren
| CAS | 1132-61-2 |
|---|---|
| Summenformel | C7H15NO4S |
| Molekulargewicht (g/mol) | 209.26 |
| MDL-Nummer | MFCD00006183 |
| InChI-Schlüssel | DVLFYONBTKHTER-UHFFFAOYSA-N |
| PubChem CID | 70807 |
| ChEBI | CHEBI:44115 |
| IUPAC-Name | 3-Morpholin-4-Ylpropan-1-Sulfonsäure |
| SMILES | [O-]S(=O)(=O)CCC[NH+]1CCOCC1 |
| Produktcode | Marke | Menge | Preis | Menge & Verfügbarkeit | |||||
|---|---|---|---|---|---|---|---|---|---|
| Produktcode | Marke | Menge | Preis | Menge & Verfügbarkeit | |||||
|
15472929
|
Thermo Scientific Alfa Aesar
J60097.AK |
250 mL |
71.20 €
250 Milliliter |
Bitte melden Sie sich an, um diesen Artikel zu kaufen. Sie benötigen ein Web-Konto? Registrieren Sie sich noch heute! | |||||
|
15482929
|
Thermo Scientific Alfa Aesar
J60097.AP |
500 mL | N/A | ||||||
Beschreibung
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Chemische Identifikatoren
| 1132-61-2 | |
| 209.26 | |
| DVLFYONBTKHTER-UHFFFAOYSA-N | |
| CHEBI:44115 | |
| [O-]S(=O)(=O)CCC[NH+]1CCOCC1 |
| C7H15NO4S | |
| MFCD00006183 | |
| 70807 | |
| 3-Morpholin-4-Ylpropan-1-Sulfonsäure |
Spezifikation
| MOPS buffer soln. | |
| Farblos | |
| 9.0 | |
| C7H15NO4S | |
| MFCD00006183 | |
| [O-]S(=O)(=O)CCC[NH+]1CCOCC1 | |
| 209.26 | |
| CHEBI:44115 |
| 1132-61-2 | |
| 1,0 M Pufferlösung | |
| Flüssigkeit | |
| Geruchsneutral | |
| DVLFYONBTKHTER-UHFFFAOYSA-N | |
| 3-Morpholin-4-Ylpropan-1-Sulfonsäure | |
| 70807 |
Sicherheit und Handhabung
GHS H-Satz
H315-H319-H335
Verursacht Hautreizungen.
Verursacht schwere Augenreizung.
Kann die Atemwege reizen.
P261-P264b-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P332+P313-P362-P501c
Gehäuse H315-H319-H335
missing translation for 'tsca' : Ja
Recommended Storage : Umgebungstemperaturen
Haben Sie Verbesserungsvorschläge?Übermitteln Sie eine inhaltliche Korrektur
Berichtigung von Produktinhalten
Bitte geben Sie uns Ihr Feedback zu den Produktinhalten, indem Sie das folgende Formular ausfüllen.
Name des Produkts